C23H27FN2O2 — CID 59251058
methyl 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhexanoate (PubChem CID 59251058) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is methyl 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhexanoate.
| Compound Name | methyl 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 59251058 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | methyl 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhexanoate |
| SMILES | COC(=O)C(C)(C)C(CC(C)C)c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H27FN2O2/c1-15(2)12-20(23(3,4)22(27)28-5)16-6-11-21-17(13-16)14-25-26(21)19-9-7-18(24)8-10-19/h6-11,13-15,20H,12H2,1-5H3 |
| InChIKey | TZLFRLVVHGIDRQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |