C13H15NO7 — CID 59253966
(2-methoxy-2-oxoethyl) 2-[4-[(2-hydroxyacetyl)amino]phenoxy]acetate (PubChem CID 59253966) has the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-[4-[(2-hydroxyacetyl)amino]phenoxy]acetate.
| Compound Name | (2-methoxy-2-oxoethyl) 2-[4-[(2-hydroxyacetyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 59253966 |
| Molecular Formula | C13H15NO7 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-[4-[(2-hydroxyacetyl)amino]phenoxy]acetate |
| SMILES | COC(=O)COC(=O)COc1ccc(NC(=O)CO)cc1 |
| InChI | InChI=1S/C13H15NO7/c1-19-12(17)7-21-13(18)8-20-10-4-2-9(3-5-10)14-11(16)6-15/h2-5,15H,6-8H2,1H3,(H,14,16) |
| InChIKey | GXZHAGJZDDJYNN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |