C28H45N3O8 — CID 59256359
2-[acetyl(methyl)amino]-N,2-dimethyl-N-[(E)-1-[4-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]ethylideneamino]propanamide (PubChem CID 59256359) has the molecular formula C28H45N3O8 and a molecular weight of 551.68 g/mol. Its IUPAC name is 2-[acetyl(methyl)amino]-N,2-dimethyl-N-[(E)-1-[4-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]ethylideneamino]propanamide.
| Compound Name | 2-[acetyl(methyl)amino]-N,2-dimethyl-N-[(E)-1-[4-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]ethylideneamino]propanamide |
|---|---|
| PubChem CID | 59256359 |
| Molecular Formula | C28H45N3O8 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | 2-[acetyl(methyl)amino]-N,2-dimethyl-N-[(E)-1-[4-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]ethylideneamino]propanamide |
| SMILES | CC(=O)CCOCCOCCOCCOCCOc1ccc(/C(C)=N/N(C)C(=O)C(C)(C)N(C)C(C)=O)cc1 |
| InChI | InChI=1S/C28H45N3O8/c1-22(32)12-13-35-14-15-36-16-17-37-18-19-38-20-21-39-26-10-8-25(9-11-26)23(2)29-31(7)27(34)28(4,5)30(6)24(3)33/h8-11H,12-21H2,1-7H3/b29-23+ |
| InChIKey | SYBFJXPRRDGCAO-BYNJWEBRSA-N |
| XLogP | 2.55 |
| TPSA | 116.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|