C21H33NO5 — CID 118426508
tert-butyl N-[4-[2-(4-acetylphenoxy)ethoxy]-2-methylbutan-2-yl]-N-methylcarbamate (PubChem CID 118426508) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(4-acetylphenoxy)ethoxy]-2-methylbutan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[2-(4-acetylphenoxy)ethoxy]-2-methylbutan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118426508 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | tert-butyl N-[4-[2-(4-acetylphenoxy)ethoxy]-2-methylbutan-2-yl]-N-methylcarbamate |
| SMILES | CC(=O)c1ccc(OCCOCCC(C)(C)N(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H33NO5/c1-16(23)17-8-10-18(11-9-17)26-15-14-25-13-12-21(5,6)22(7)19(24)27-20(2,3)4/h8-11H,12-15H2,1-7H3 |
| InChIKey | CFWUZEOVQMNZCI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|