C18H25N3O8 — CID 59257577
3-[2-[2-[2-[2-(2,1,3-benzoxadiazole-5-carbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 59257577) has the molecular formula C18H25N3O8 and a molecular weight of 411.41 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(2,1,3-benzoxadiazole-5-carbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-(2,1,3-benzoxadiazole-5-carbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 59257577 |
| Molecular Formula | C18H25N3O8 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-[2-[2-[2-[2-(2,1,3-benzoxadiazole-5-carbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCOCCOCCNC(=O)c1ccc2nonc2c1 |
| InChI | InChI=1S/C18H25N3O8/c22-17(23)3-5-25-7-9-27-11-12-28-10-8-26-6-4-19-18(24)14-1-2-15-16(13-14)21-29-20-15/h1-2,13H,3-12H2,(H,19,24)(H,22,23) |
| InChIKey | OCLKCUVWVQYVQU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|