About 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one
2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one (PubChem CID 59262372) has the molecular formula C29H30N4O2
and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one |
| PubChem CID | 59262372 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1CC1CCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H30N4O2/c30-28-31-29(24-12-6-2-7-13-24,25-14-8-3-9-15-25)27(35)33(28)21-23-16-18-32(19-17-23)26(34)20-22-10-4-1-5-11-22/h1-15,23H,16-21H2,(H2,30,31) |
| InChIKey | ZCXWJKCNWQXXPX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one?
The IUPAC name of 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one (CID 59262372) is 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one.
What is the SMILES notation for 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one?
The canonical SMILES for 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one is NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1CC1CCN(C(=O)Cc2ccccc2)CC1.
What is the InChIKey of 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one?
The InChIKey is ZCXWJKCNWQXXPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30N4O2/c30-28-31-29(24-12-6-2-7-13-24,25-14-8-3-9-15-25)27(35)33(28)21-23-16-18-32(19-17-23)26(34)20-22-10-4-1-5-11-22/h1-15,23H,16-21H2,(H2,30,31).
What are the key properties of 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one?
2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one has a molecular weight of 466.59 g/mol, XLogP of 3.57, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,5-diphenyl-3-[[1-(2-phenylacetyl)piperidin-4-yl]methyl]imidazol-4-one is sourced from PubChem (CID 59262372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).