C20H21N5O2S — CID 59262713
N-[3-[[4-[(dimethylamino)methyl]-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]phenyl]acetamide (PubChem CID 59262713) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is N-[3-[[4-[(dimethylamino)methyl]-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-[(dimethylamino)methyl]-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 59262713 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[3-[[4-[(dimethylamino)methyl]-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncc3c(n2)-c2cc(CN(C)C)sc2CO3)c1 |
| InChI | InChI=1S/C20H21N5O2S/c1-12(26)22-13-5-4-6-14(7-13)23-20-21-9-17-19(24-20)16-8-15(10-25(2)3)28-18(16)11-27-17/h4-9H,10-11H2,1-3H3,(H,22,26)(H,21,23,24) |
| InChIKey | DTZZVVUTYYOIDP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |