C19H17N5O3S2 — CID 59262750
N,N-dimethyl-2-(3-sulfamoylanilino)thieno[2,3-h]quinazoline-8-carboxamide (PubChem CID 59262750) has the molecular formula C19H17N5O3S2 and a molecular weight of 427.51 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-sulfamoylanilino)thieno[2,3-h]quinazoline-8-carboxamide.
| Compound Name | N,N-dimethyl-2-(3-sulfamoylanilino)thieno[2,3-h]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 59262750 |
| Molecular Formula | C19H17N5O3S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N,N-dimethyl-2-(3-sulfamoylanilino)thieno[2,3-h]quinazoline-8-carboxamide |
| SMILES | CN(C)C(=O)c1cc2c(ccc3cnc(Nc4cccc(S(N)(=O)=O)c4)nc32)s1 |
| InChI | InChI=1S/C19H17N5O3S2/c1-24(2)18(25)16-9-14-15(28-16)7-6-11-10-21-19(23-17(11)14)22-12-4-3-5-13(8-12)29(20,26)27/h3-10H,1-2H3,(H2,20,26,27)(H,21,22,23) |
| InChIKey | RDSGPJWYWFVUFU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |