C22H22N4O4S2 — CID 11677152
[2-(3-sulfamoylanilino)thieno[2,3-h]quinazolin-8-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11677152) has the molecular formula C22H22N4O4S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is [2-(3-sulfamoylanilino)thieno[2,3-h]quinazolin-8-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [2-(3-sulfamoylanilino)thieno[2,3-h]quinazolin-8-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11677152 |
| Molecular Formula | C22H22N4O4S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | [2-(3-sulfamoylanilino)thieno[2,3-h]quinazolin-8-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1cc2c(ccc3cnc(Nc4cccc(S(N)(=O)=O)c4)nc32)s1 |
| InChI | InChI=1S/C22H22N4O4S2/c1-22(2,3)20(27)30-12-15-10-17-18(31-15)8-7-13-11-24-21(26-19(13)17)25-14-5-4-6-16(9-14)32(23,28)29/h4-11H,12H2,1-3H3,(H2,23,28,29)(H,24,25,26) |
| InChIKey | HONSRXWRVDXPDE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |