C17H19N2O6P — CID 59263320
methyl 6-[[3-hydroxy-5-[(2S)-1-phosphanyloxypropan-2-yl]oxybenzoyl]amino]pyridine-3-carboxylate (PubChem CID 59263320) has the molecular formula C17H19N2O6P and a molecular weight of 378.32 g/mol. Its IUPAC name is methyl 6-[[3-hydroxy-5-[(2S)-1-phosphanyloxypropan-2-yl]oxybenzoyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[3-hydroxy-5-[(2S)-1-phosphanyloxypropan-2-yl]oxybenzoyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59263320 |
| Molecular Formula | C17H19N2O6P |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | methyl 6-[[3-hydroxy-5-[(2S)-1-phosphanyloxypropan-2-yl]oxybenzoyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(O)cc(O[C@@H](C)COP)c2)nc1 |
| InChI | InChI=1S/C17H19N2O6P/c1-10(9-24-26)25-14-6-12(5-13(20)7-14)16(21)19-15-4-3-11(8-18-15)17(22)23-2/h3-8,10,20H,9,26H2,1-2H3,(H,18,19,21)/t10-/m0/s1 |
| InChIKey | JBYPUTMNSSBXGO-JTQLQIEISA-N |
| XLogP | 2.40 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|