About CID 59264388
CID 59264388 (PubChem CID 59264388) has the molecular formula C7H15BNO4P
and a molecular weight of 218.99 g/mol.
Molecular Properties
| Compound Name | CID 59264388 |
| PubChem CID | 59264388 |
| Molecular Formula | C7H15BNO4P |
| Molecular Weight | 218.99 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](NP(C)(=O)O)[C@@H](COC)O1 |
| InChI | InChI=1S/C7H15BNO4P/c1-12-4-6-5(3-7(8)13-6)9-14(2,10)11/h5-7H,3-4H2,1-2H3,(H2,9,10,11)/t5-,6-,7-/m1/s1 |
| InChIKey | YVOBABASAKKZEB-FSDSQADBSA-N |
| XLogP | -0.31 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.99 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 59264388 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59264388?
The IUPAC name of CID 59264388 (CID 59264388) is not available.
What is the SMILES notation for CID 59264388?
The canonical SMILES for CID 59264388 is [B][C@H]1C[C@@H](NP(C)(=O)O)[C@@H](COC)O1.
What is the InChIKey of CID 59264388?
The InChIKey is YVOBABASAKKZEB-FSDSQADBSA-N. The full InChI is InChI=1S/C7H15BNO4P/c1-12-4-6-5(3-7(8)13-6)9-14(2,10)11/h5-7H,3-4H2,1-2H3,(H2,9,10,11)/t5-,6-,7-/m1/s1.
What are the key properties of CID 59264388?
CID 59264388 has a molecular weight of 218.99 g/mol, XLogP of -0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59264388 is sourced from PubChem (CID 59264388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).