C8H17FNO4P — CID 174097852
N-[(2S,4S,5S)-4-fluoro-2-(methoxymethyl)-5-methyloxolan-3-yl]-methylphosphonamidic acid (PubChem CID 174097852) has the molecular formula C8H17FNO4P and a molecular weight of 241.20 g/mol. Its IUPAC name is N-[(2S,4S,5S)-4-fluoro-2-(methoxymethyl)-5-methyloxolan-3-yl]-methylphosphonamidic acid.
| Compound Name | N-[(2S,4S,5S)-4-fluoro-2-(methoxymethyl)-5-methyloxolan-3-yl]-methylphosphonamidic acid |
|---|---|
| PubChem CID | 174097852 |
| Molecular Formula | C8H17FNO4P |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-[(2S,4S,5S)-4-fluoro-2-(methoxymethyl)-5-methyloxolan-3-yl]-methylphosphonamidic acid |
| SMILES | COC[C@H]1O[C@@H](C)[C@@H](F)C1NP(C)(=O)O |
| InChI | InChI=1S/C8H17FNO4P/c1-5-7(9)8(10-15(3,11)12)6(14-5)4-13-2/h5-8H,4H2,1-3H3,(H2,10,11,12)/t5-,6+,7+,8?/m0/s1 |
| InChIKey | UXYMYCOZEYBKQN-FWYCZPIQSA-N |
| XLogP | 0.53 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|