C7H15FNO6P — CID 171771244
[[(3S,4S)-5-fluoro-3,4-dihydroxy-6-methyloxan-2-yl]methylamino]phosphonic acid (PubChem CID 171771244) has the molecular formula C7H15FNO6P and a molecular weight of 259.17 g/mol. Its IUPAC name is [[(3S,4S)-5-fluoro-3,4-dihydroxy-6-methyloxan-2-yl]methylamino]phosphonic acid.
| Compound Name | [[(3S,4S)-5-fluoro-3,4-dihydroxy-6-methyloxan-2-yl]methylamino]phosphonic acid |
|---|---|
| PubChem CID | 171771244 |
| Molecular Formula | C7H15FNO6P |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | [[(3S,4S)-5-fluoro-3,4-dihydroxy-6-methyloxan-2-yl]methylamino]phosphonic acid |
| SMILES | CC1OC(CNP(=O)(O)O)[C@@H](O)[C@H](O)C1F |
| InChI | InChI=1S/C7H15FNO6P/c1-3-5(8)7(11)6(10)4(15-3)2-9-16(12,13)14/h3-7,10-11H,2H2,1H3,(H3,9,12,13,14)/t3?,4?,5?,6-,7-/m1/s1 |
| InChIKey | MDJKKVBUNHHOGY-CSFZXIAZSA-N |
| XLogP | -1.48 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|