C8H17NO4 — CID 91390679
2-methyl-6-(methylaminomethyl)oxane-3,4,5-triol (PubChem CID 91390679) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-methyl-6-(methylaminomethyl)oxane-3,4,5-triol.
| Compound Name | 2-methyl-6-(methylaminomethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91390679 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 2-methyl-6-(methylaminomethyl)oxane-3,4,5-triol |
| SMILES | CNCC1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C8H17NO4/c1-4-6(10)8(12)7(11)5(13-4)3-9-2/h4-12H,3H2,1-2H3 |
| InChIKey | ANOVFARYALQEDY-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |