C13H12O4S2 — CID 59264655
4-(5-ethylsulfonylthiophen-2-yl)benzoic acid (PubChem CID 59264655) has the molecular formula C13H12O4S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-(5-ethylsulfonylthiophen-2-yl)benzoic acid.
| Compound Name | 4-(5-ethylsulfonylthiophen-2-yl)benzoic acid |
|---|---|
| PubChem CID | 59264655 |
| Molecular Formula | C13H12O4S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 4-(5-ethylsulfonylthiophen-2-yl)benzoic acid |
| SMILES | CCS(=O)(=O)c1ccc(-c2ccc(C(=O)O)cc2)s1 |
| InChI | InChI=1S/C13H12O4S2/c1-2-19(16,17)12-8-7-11(18-12)9-3-5-10(6-4-9)13(14)15/h3-8H,2H2,1H3,(H,14,15) |
| InChIKey | YXCNLPNFOKPHNN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |