C4H11O5P2S- — CID 59267129
2-[hydroxy(methyl)phosphoryl]oxyethylsulfanyl-methylphosphinate (PubChem CID 59267129) has the molecular formula C4H11O5P2S- and a molecular weight of 233.14 g/mol. Its IUPAC name is 2-[hydroxy(methyl)phosphoryl]oxyethylsulfanyl-methylphosphinate.
| Compound Name | 2-[hydroxy(methyl)phosphoryl]oxyethylsulfanyl-methylphosphinate |
|---|---|
| PubChem CID | 59267129 |
| Molecular Formula | C4H11O5P2S- |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | 2-[hydroxy(methyl)phosphoryl]oxyethylsulfanyl-methylphosphinate |
| SMILES | CP(=O)(O)OCCSP(C)(=O)[O-] |
| InChI | InChI=1S/C4H12O5P2S/c1-10(5,6)9-3-4-12-11(2,7)8/h3-4H2,1-2H3,(H,5,6)(H,7,8)/p-1 |
| InChIKey | CLDMNYSJALUJHZ-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|