About 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate
2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate (PubChem CID 59270025) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate |
| PubChem CID | 59270025 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate |
| SMILES | C=CC(=O)NCCC(=O)OC(C)(C)CC |
| InChI | InChI=1S/C11H19NO3/c1-5-9(13)12-8-7-10(14)15-11(3,4)6-2/h5H,1,6-8H2,2-4H3,(H,12,13) |
| InChIKey | SVPQRLOWFYVCOD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate?
The IUPAC name of 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate (CID 59270025) is 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate.
What is the SMILES notation for 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate?
The canonical SMILES for 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate is C=CC(=O)NCCC(=O)OC(C)(C)CC.
What is the InChIKey of 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate?
The InChIKey is SVPQRLOWFYVCOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-5-9(13)12-8-7-10(14)15-11(3,4)6-2/h5H,1,6-8H2,2-4H3,(H,12,13).
What are the key properties of 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate?
2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate has a molecular weight of 213.28 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 3-(prop-2-enoylamino)propanoate is sourced from PubChem (CID 59270025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).