C11H22N2O3 — CID 87146798
azane;[2,3-dimethyl-4-(prop-2-enoylamino)butan-2-yl] acetate (PubChem CID 87146798) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is azane;[2,3-dimethyl-4-(prop-2-enoylamino)butan-2-yl] acetate.
| Compound Name | azane;[2,3-dimethyl-4-(prop-2-enoylamino)butan-2-yl] acetate |
|---|---|
| PubChem CID | 87146798 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | azane;[2,3-dimethyl-4-(prop-2-enoylamino)butan-2-yl] acetate |
| SMILES | C=CC(=O)NCC(C)C(C)(C)OC(C)=O.N |
| InChI | InChI=1S/C11H19NO3.H3N/c1-6-10(14)12-7-8(2)11(4,5)15-9(3)13;/h6,8H,1,7H2,2-5H3,(H,12,14);1H3 |
| InChIKey | ABRQZCSHKIGMIF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|