C23H17NO7 — CID 59271098
(2-oxochromen-7-yl) 4-[3-(2,5-dioxopyrrol-1-yl)propoxy]benzoate (PubChem CID 59271098) has the molecular formula C23H17NO7 and a molecular weight of 419.39 g/mol. Its IUPAC name is (2-oxochromen-7-yl) 4-[3-(2,5-dioxopyrrol-1-yl)propoxy]benzoate.
| Compound Name | (2-oxochromen-7-yl) 4-[3-(2,5-dioxopyrrol-1-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 59271098 |
| Molecular Formula | C23H17NO7 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | (2-oxochromen-7-yl) 4-[3-(2,5-dioxopyrrol-1-yl)propoxy]benzoate |
| SMILES | O=C(Oc1ccc2ccc(=O)oc2c1)c1ccc(OCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C23H17NO7/c25-20-9-10-21(26)24(20)12-1-13-29-17-6-3-16(4-7-17)23(28)30-18-8-2-15-5-11-22(27)31-19(15)14-18/h2-11,14H,1,12-13H2 |
| InChIKey | OVTWJCVROAEITO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|