C17H26N6 — CID 59279365
4-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]piperidin-4-amine (PubChem CID 59279365) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is 4-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]piperidin-4-amine.
| Compound Name | 4-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 59279365 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 4-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]piperidin-4-amine |
| SMILES | CN1CCN(c2ccc3nc(C4(N)CCNCC4)[nH]c3c2)CC1 |
| InChI | InChI=1S/C17H26N6/c1-22-8-10-23(11-9-22)13-2-3-14-15(12-13)21-16(20-14)17(18)4-6-19-7-5-17/h2-3,12,19H,4-11,18H2,1H3,(H,20,21) |
| InChIKey | MOFWKAVGMQNYPN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |