C13H16ClN3 — CID 61292154
1-(6-chloro-1H-benzimidazol-2-yl)cyclohexan-1-amine (PubChem CID 61292154) has the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. Its IUPAC name is 1-(6-chloro-1H-benzimidazol-2-yl)cyclohexan-1-amine.
| Compound Name | 1-(6-chloro-1H-benzimidazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 61292154 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(6-chloro-1H-benzimidazol-2-yl)cyclohexan-1-amine |
| SMILES | NC1(c2nc3ccc(Cl)cc3[nH]2)CCCCC1 |
| InChI | InChI=1S/C13H16ClN3/c14-9-4-5-10-11(8-9)17-12(16-10)13(15)6-2-1-3-7-13/h4-5,8H,1-3,6-7,15H2,(H,16,17) |
| InChIKey | LUFPGSTUISDSED-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |