C17H23NO6S — CID 59280277
methyl 4-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]-propan-2-ylsulfamoyl]benzoate (PubChem CID 59280277) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is methyl 4-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]-propan-2-ylsulfamoyl]benzoate.
| Compound Name | methyl 4-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]-propan-2-ylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 59280277 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | methyl 4-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]-propan-2-ylsulfamoyl]benzoate |
| SMILES | C=CC[C@@H](C(=O)OC)N(C(C)C)S(=O)(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C17H23NO6S/c1-6-7-15(17(20)24-5)18(12(2)3)25(21,22)14-10-8-13(9-11-14)16(19)23-4/h6,8-12,15H,1,7H2,2-5H3/t15-/m0/s1 |
| InChIKey | QTCMPKOEIXHTFJ-HNNXBMFYSA-N |
| XLogP | 1.99 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|