C13H10F3N2OS- — CID 59280725
N,4-dimethyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboximidate (PubChem CID 59280725) has the molecular formula C13H10F3N2OS- and a molecular weight of 299.30 g/mol. Its IUPAC name is N,4-dimethyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboximidate.
| Compound Name | N,4-dimethyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboximidate |
|---|---|
| PubChem CID | 59280725 |
| Molecular Formula | C13H10F3N2OS- |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N,4-dimethyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboximidate |
| SMILES | C/N=C(\[O-])c1sc(-c2ccc(C(F)(F)F)cc2)nc1C |
| InChI | InChI=1S/C13H11F3N2OS/c1-7-10(11(19)17-2)20-12(18-7)8-3-5-9(6-4-8)13(14,15)16/h3-6H,1-2H3,(H,17,19)/p-1 |
| InChIKey | NGKZYIDFBCYDJZ-UHFFFAOYSA-M |
| XLogP | 2.87 |
| TPSA | 48.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|