C9H12GdN2O4 — CID 59283138
N-(2-aminoethyl)-3-hydroxy-6-methyl-4-oxopyran-2-carboxamide;gadolinium (PubChem CID 59283138) has the molecular formula C9H12GdN2O4 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-hydroxy-6-methyl-4-oxopyran-2-carboxamide;gadolinium.
| Compound Name | N-(2-aminoethyl)-3-hydroxy-6-methyl-4-oxopyran-2-carboxamide;gadolinium |
|---|---|
| PubChem CID | 59283138 |
| Molecular Formula | C9H12GdN2O4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | N-(2-aminoethyl)-3-hydroxy-6-methyl-4-oxopyran-2-carboxamide;gadolinium |
| SMILES | Cc1cc(=O)c(O)c(C(=O)NCCN)o1.[Gd] |
| InChI | InChI=1S/C9H12N2O4.Gd/c1-5-4-6(12)7(13)8(15-5)9(14)11-3-2-10;/h4,13H,2-3,10H2,1H3,(H,11,14); |
| InChIKey | LLFGHNIBZFNPNF-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |