C16H11F2O7S- — CID 59283743
1,1-difluoro-2-(6-prop-2-enoyloxynaphthalene-2-carbonyl)oxyethanesulfonate (PubChem CID 59283743) has the molecular formula C16H11F2O7S- and a molecular weight of 385.32 g/mol. Its IUPAC name is 1,1-difluoro-2-(6-prop-2-enoyloxynaphthalene-2-carbonyl)oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-(6-prop-2-enoyloxynaphthalene-2-carbonyl)oxyethanesulfonate |
|---|---|
| PubChem CID | 59283743 |
| Molecular Formula | C16H11F2O7S- |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 1,1-difluoro-2-(6-prop-2-enoyloxynaphthalene-2-carbonyl)oxyethanesulfonate |
| SMILES | C=CC(=O)Oc1ccc2cc(C(=O)OCC(F)(F)S(=O)(=O)[O-])ccc2c1 |
| InChI | InChI=1S/C16H12F2O7S/c1-2-14(19)25-13-6-5-10-7-12(4-3-11(10)8-13)15(20)24-9-16(17,18)26(21,22)23/h2-8H,1,9H2,(H,21,22,23)/p-1 |
| InChIKey | AMZRWXCJWIXZOM-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|