About CID 59283937
CID 59283937 (PubChem CID 59283937) has the molecular formula C8H14BNO2
and a molecular weight of 167.02 g/mol.
Molecular Properties
| Compound Name | CID 59283937 |
| PubChem CID | 59283937 |
| Molecular Formula | C8H14BNO2 |
| Molecular Weight | 167.02 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)N(CCC)CC(C)=O |
| InChI | InChI=1S/C8H14BNO2/c1-3-4-10(6-7(2)11)8(12)5-9/h3-6H2,1-2H3 |
| InChIKey | BJCBUFYHUQPCBP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.02 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59283937 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59283937?
The IUPAC name of CID 59283937 (CID 59283937) is not available.
What is the SMILES notation for CID 59283937?
The canonical SMILES for CID 59283937 is [B]CC(=O)N(CCC)CC(C)=O.
What is the InChIKey of CID 59283937?
The InChIKey is BJCBUFYHUQPCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14BNO2/c1-3-4-10(6-7(2)11)8(12)5-9/h3-6H2,1-2H3.
What are the key properties of CID 59283937?
CID 59283937 has a molecular weight of 167.02 g/mol, XLogP of 0.40, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59283937 is sourced from PubChem (CID 59283937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).