C10H10N2O — CID 59284093
5,7-Dimethyl-1,7-naphthyridin-6-one (PubChem CID 59284093) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 5,7-dimethyl-1,7-naphthyridin-6-one.
| Compound Name | 5,7-Dimethyl-1,7-naphthyridin-6-one |
|---|---|
| PubChem CID | 59284093 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 5,7-dimethyl-1,7-naphthyridin-6-one |
| SMILES | CC1=C2C=CC=NC2=CN(C1=O)C |
| InChI | InChI=1S/C10H10N2O/c1-7-8-4-3-5-11-9(8)6-12(2)10(7)13/h3-6H,1-2H3 |
| InChIKey | FWIWTUVYFASDOG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 32.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | 386 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |