C21H22BrN3O2 — CID 59286268
methyl 2-[[4-bromo-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-ethylbenzoate (PubChem CID 59286268) has the molecular formula C21H22BrN3O2 and a molecular weight of 428.33 g/mol. Its IUPAC name is methyl 2-[[4-bromo-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-ethylbenzoate.
| Compound Name | methyl 2-[[4-bromo-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-ethylbenzoate |
|---|---|
| PubChem CID | 59286268 |
| Molecular Formula | C21H22BrN3O2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | methyl 2-[[4-bromo-3-methyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-5-ethylbenzoate |
| SMILES | CCc1ccc(Nc2c(Br)c(C)nn2-c2ccccc2C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C21H22BrN3O2/c1-5-15-10-11-17(16(12-15)21(26)27-4)23-20-19(22)14(3)24-25(20)18-9-7-6-8-13(18)2/h6-12,23H,5H2,1-4H3 |
| InChIKey | YXFORWQILGICOF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |