C20H16BrCl3N6O4 — CID 59286902
ethyl N-[[2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-3,5-dichlorobenzoyl]-methylamino]carbamate (PubChem CID 59286902) has the molecular formula C20H16BrCl3N6O4 and a molecular weight of 590.65 g/mol. Its IUPAC name is ethyl N-[[2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-3,5-dichlorobenzoyl]-methylamino]carbamate.
| Compound Name | ethyl N-[[2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-3,5-dichlorobenzoyl]-methylamino]carbamate |
|---|---|
| PubChem CID | 59286902 |
| Molecular Formula | C20H16BrCl3N6O4 |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 587.95 |
| IUPAC Name | ethyl N-[[2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-3,5-dichlorobenzoyl]-methylamino]carbamate |
| SMILES | CCOC(=O)NN(C)C(=O)c1cc(Cl)cc(Cl)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C20H16BrCl3N6O4/c1-3-34-20(33)28-29(2)19(32)11-7-10(22)8-13(24)16(11)26-18(31)14-9-15(21)27-30(14)17-12(23)5-4-6-25-17/h4-9H,3H2,1-2H3,(H,26,31)(H,28,33) |
| InChIKey | MVGXDTRADCWGMI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|