C25H18BrCl3N6O4 — CID 71514344
N-[2-[[2-(benzylamino)-2-oxoethoxy]carbamoyl]-4,6-dichlorophenyl]-3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide (PubChem CID 71514344) has the molecular formula C25H18BrCl3N6O4 and a molecular weight of 652.72 g/mol. Its IUPAC name is N-[2-[[2-(benzylamino)-2-oxoethoxy]carbamoyl]-4,6-dichlorophenyl]-3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide.
| Compound Name | N-[2-[[2-(benzylamino)-2-oxoethoxy]carbamoyl]-4,6-dichlorophenyl]-3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71514344 |
| Molecular Formula | C25H18BrCl3N6O4 |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 649.96 |
| IUPAC Name | N-[2-[[2-(benzylamino)-2-oxoethoxy]carbamoyl]-4,6-dichlorophenyl]-3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide |
| SMILES | O=C(CONC(=O)c1cc(Cl)cc(Cl)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl)NCc1ccccc1 |
| InChI | InChI=1S/C25H18BrCl3N6O4/c26-20-11-19(35(33-20)23-17(28)7-4-8-30-23)25(38)32-22-16(9-15(27)10-18(22)29)24(37)34-39-13-21(36)31-12-14-5-2-1-3-6-14/h1-11H,12-13H2,(H,31,36)(H,32,38)(H,34,37) |
| InChIKey | QNLUHHWCONOJGV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|