C18H18F4O2 — CID 59287355
[2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-(trifluoromethyl)phenyl]methanol (PubChem CID 59287355) has the molecular formula C18H18F4O2 and a molecular weight of 342.33 g/mol. Its IUPAC name is [2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-(trifluoromethyl)phenyl]methanol.
| Compound Name | [2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 59287355 |
| Molecular Formula | C18H18F4O2 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [2-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-4-(trifluoromethyl)phenyl]methanol |
| SMILES | COc1cc(F)c(C(C)C)cc1-c1cc(C(F)(F)F)ccc1CO |
| InChI | InChI=1S/C18H18F4O2/c1-10(2)13-7-15(17(24-3)8-16(13)19)14-6-12(18(20,21)22)5-4-11(14)9-23/h4-8,10,23H,9H2,1-3H3 |
| InChIKey | HBQBFBCREPWTCS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |