C20H19BF4N2O2 — CID 88951056
CID 88951056 (PubChem CID 88951056) has the molecular formula C20H19BF4N2O2 and a molecular weight of 406.19 g/mol.
| Compound Name | CID 88951056 |
|---|---|
| PubChem CID | 88951056 |
| Molecular Formula | C20H19BF4N2O2 |
| Molecular Weight | 406.19 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | — |
| SMILES | [B]N1C(=O)NCC1c1cc(C(F)(F)F)ccc1-c1cc(C(C)C)c(F)cc1OC |
| InChI | InChI=1S/C20H19BF4N2O2/c1-10(2)13-7-15(18(29-3)8-16(13)22)12-5-4-11(20(23,24)25)6-14(12)17-9-26-19(28)27(17)21/h4-8,10,17H,9H2,1-3H3,(H,26,28) |
| InChIKey | MVRXUEKXVDUTPZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.19 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|