C29H39N11O3S2 — CID 59289727
1-(1,3-benzothiazol-2-yl)-3-[[2,4-bis(1-methoxypropan-2-ylamino)-6-[3-(1-sulfanylpropan-2-yloxy)propylamino]pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile (PubChem CID 59289727) has the molecular formula C29H39N11O3S2 and a molecular weight of 653.84 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[[2,4-bis(1-methoxypropan-2-ylamino)-6-[3-(1-sulfanylpropan-2-yloxy)propylamino]pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[[2,4-bis(1-methoxypropan-2-ylamino)-6-[3-(1-sulfanylpropan-2-yloxy)propylamino]pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 59289727 |
| Molecular Formula | C29H39N11O3S2 |
| Molecular Weight | 653.84 g/mol |
| Exact Mass | 653.27 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[[2,4-bis(1-methoxypropan-2-ylamino)-6-[3-(1-sulfanylpropan-2-yloxy)propylamino]pyrimidin-5-yl]diazenyl]pyrazole-4-carbonitrile |
| SMILES | COCC(C)Nc1nc(NCCCOC(C)CS)c(/N=N/c2nn(-c3nc4ccccc4s3)cc2C#N)c(NC(C)COC)n1 |
| InChI | InChI=1S/C29H39N11O3S2/c1-18(15-41-4)32-27-24(26(31-11-8-12-43-20(3)17-44)35-28(36-27)33-19(2)16-42-5)37-38-25-21(13-30)14-40(39-25)29-34-22-9-6-7-10-23(22)45-29/h6-7,9-10,14,18-20,44H,8,11-12,15-17H2,1-5H3,(H3,31,32,33,35,36)/b38-37+ |
| InChIKey | ROBRTODNJMNKKN-HEFFKOSUSA-N |
| XLogP | 5.59 |
| TPSA | 168.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.84 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|