C14H16BrFN2O2 — CID 59291273
1-azabicyclo[2.2.2]octan-3-yl N-(2-bromo-3-fluorophenyl)carbamate (PubChem CID 59291273) has the molecular formula C14H16BrFN2O2 and a molecular weight of 343.20 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl N-(2-bromo-3-fluorophenyl)carbamate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl N-(2-bromo-3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 59291273 |
| Molecular Formula | C14H16BrFN2O2 |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl N-(2-bromo-3-fluorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(F)c1Br)OC1CN2CCC1CC2 |
| InChI | InChI=1S/C14H16BrFN2O2/c15-13-10(16)2-1-3-11(13)17-14(19)20-12-8-18-6-4-9(12)5-7-18/h1-3,9,12H,4-8H2,(H,17,19) |
| InChIKey | JARCBFMCHPWHCR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |