About [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate (PubChem CID 59291481) has the molecular formula C17H17F2N3O2S
and a molecular weight of 365.41 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate.
Molecular Properties
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate |
| PubChem CID | 59291481 |
| Molecular Formula | C17H17F2N3O2S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate |
| SMILES | O=C(Nc1ncsc1-c1cccc(F)c1F)O[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C17H17F2N3O2S/c18-12-3-1-2-11(14(12)19)15-16(20-9-25-15)21-17(23)24-13-8-22-6-4-10(13)5-7-22/h1-3,9-10,13H,4-8H2,(H,21,23)/t13-/m0/s1 |
| InChIKey | MQEZJDQETUGKKO-ZDUSSCGKSA-N |
| XLogP | 3.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate?
The IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate (CID 59291481) is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate.
What is the SMILES notation for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate?
The canonical SMILES for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate is O=C(Nc1ncsc1-c1cccc(F)c1F)O[C@H]1CN2CCC1CC2.
What is the InChIKey of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate?
The InChIKey is MQEZJDQETUGKKO-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H17F2N3O2S/c18-12-3-1-2-11(14(12)19)15-16(20-9-25-15)21-17(23)24-13-8-22-6-4-10(13)5-7-22/h1-3,9-10,13H,4-8H2,(H,21,23)/t13-/m0/s1.
What are the key properties of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate?
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate has a molecular weight of 365.41 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,3-difluorophenyl)-1,3-thiazol-4-yl]carbamate is sourced from PubChem (CID 59291481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).