C20H17Cl2N5O — CID 59292071
4-chloro-N-[(3-chlorophenyl)methyl]-2-(2-pyrazol-1-ylethyl)indazole-6-carboxamide (PubChem CID 59292071) has the molecular formula C20H17Cl2N5O and a molecular weight of 414.30 g/mol. Its IUPAC name is 4-chloro-N-[(3-chlorophenyl)methyl]-2-(2-pyrazol-1-ylethyl)indazole-6-carboxamide.
| Compound Name | 4-chloro-N-[(3-chlorophenyl)methyl]-2-(2-pyrazol-1-ylethyl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 59292071 |
| Molecular Formula | C20H17Cl2N5O |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 4-chloro-N-[(3-chlorophenyl)methyl]-2-(2-pyrazol-1-ylethyl)indazole-6-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1cc(Cl)c2cn(CCn3cccn3)nc2c1 |
| InChI | InChI=1S/C20H17Cl2N5O/c21-16-4-1-3-14(9-16)12-23-20(28)15-10-18(22)17-13-27(25-19(17)11-15)8-7-26-6-2-5-24-26/h1-6,9-11,13H,7-8,12H2,(H,23,28) |
| InChIKey | XKXVFJGWLDBZBS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |