C21H15ClFN3O — CID 58138781
N-[(3-chlorophenyl)methyl]-1-(4-fluorophenyl)indazole-4-carboxamide (PubChem CID 58138781) has the molecular formula C21H15ClFN3O and a molecular weight of 379.82 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-1-(4-fluorophenyl)indazole-4-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-1-(4-fluorophenyl)indazole-4-carboxamide |
|---|---|
| PubChem CID | 58138781 |
| Molecular Formula | C21H15ClFN3O |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-1-(4-fluorophenyl)indazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1cccc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15ClFN3O/c22-15-4-1-3-14(11-15)12-24-21(27)18-5-2-6-20-19(18)13-25-26(20)17-9-7-16(23)8-10-17/h1-11,13H,12H2,(H,24,27) |
| InChIKey | VUJKWDPRLOTRFG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |