C22H15ClF3N3O — CID 58138845
1-(4-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]indazole-4-carboxamide (PubChem CID 58138845) has the molecular formula C22H15ClF3N3O and a molecular weight of 429.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]indazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 58138845 |
| Molecular Formula | C22H15ClF3N3O |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]indazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1cccc2c1cnn2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H15ClF3N3O/c23-16-7-9-17(10-8-16)29-20-6-2-5-18(19(20)13-28-29)21(30)27-12-14-3-1-4-15(11-14)22(24,25)26/h1-11,13H,12H2,(H,27,30) |
| InChIKey | WJTALSVMAYNMLG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |