C7H14N2O — CID 59293963
1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxamide (PubChem CID 59293963) has the molecular formula C7H14N2O and a molecular weight of 147.23 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59293963 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 147.23 g/mol |
| Exact Mass | 147.14 |
| IUPAC Name | 1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxamide |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1CCCC1C(N)=O |
| InChI | InChI=1S/C7H14N2O/c1-2-9-5-3-4-6(9)7(8)10/h6H,2-5H2,1H3,(H2,8,10)/i1D3,2D2 |
| InChIKey | LQOASEHNECNLNM-ZBJDZAJPSA-N |
| XLogP | -0.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |