C10H20N2O — CID 58877739
(2R)-1-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide (PubChem CID 58877739) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is (2R)-1-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58877739 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (2R)-1-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)CN1CCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C10H20N2O/c1-10(2,3)7-12-6-4-5-8(12)9(11)13/h8H,4-7H2,1-3H3,(H2,11,13)/t8-/m1/s1 |
| InChIKey | DOYHLGZQAFUFFL-MRVPVSSYSA-N |
| XLogP | 0.98 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |