C35H30IrN4O-2 — CID 59294188
iridium;bis(2-phenylpyridine);4-[2-(2H-pyrrol-2-ylmethylideneamino)ethyl]phenol (PubChem CID 59294188) has the molecular formula C35H30IrN4O-2 and a molecular weight of 714.87 g/mol. Its IUPAC name is iridium;bis(2-phenylpyridine);4-[2-(2H-pyrrol-2-ylmethylideneamino)ethyl]phenol.
| Compound Name | iridium;bis(2-phenylpyridine);4-[2-(2H-pyrrol-2-ylmethylideneamino)ethyl]phenol |
|---|---|
| PubChem CID | 59294188 |
| Molecular Formula | C35H30IrN4O-2 |
| Molecular Weight | 714.87 g/mol |
| Exact Mass | 715.21 |
| IUPAC Name | iridium;bis(2-phenylpyridine);4-[2-(2H-pyrrol-2-ylmethylideneamino)ethyl]phenol |
| SMILES | Oc1ccc(CC/N=C/C2C=CC=N2)cc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C13H14N2O.2C11H8N.Ir/c16-13-5-3-11(4-6-13)7-9-14-10-12-2-1-8-15-12;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-6,8,10,12,16H,7,9H2;2*1-6,8-9H;/q;2*-1;/b14-10+;;; |
| InChIKey | MSOWCVALTZRELO-DYVFDRNCSA-N |
| XLogP | 7.11 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.87 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|