C27H26O10 — CID 59294986
[2,3-diacetyloxy-4-[2-hydroxy-4-(4-oxochromen-2-yl)phenoxy]cyclopentyl]methyl acetate (PubChem CID 59294986) has the molecular formula C27H26O10 and a molecular weight of 510.50 g/mol. Its IUPAC name is [2,3-diacetyloxy-4-[2-hydroxy-4-(4-oxochromen-2-yl)phenoxy]cyclopentyl]methyl acetate.
| Compound Name | [2,3-diacetyloxy-4-[2-hydroxy-4-(4-oxochromen-2-yl)phenoxy]cyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 59294986 |
| Molecular Formula | C27H26O10 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [2,3-diacetyloxy-4-[2-hydroxy-4-(4-oxochromen-2-yl)phenoxy]cyclopentyl]methyl acetate |
| SMILES | CC(=O)OCC1CC(Oc2ccc(-c3cc(=O)c4ccccc4o3)cc2O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C27H26O10/c1-14(28)33-13-18-11-25(27(35-16(3)30)26(18)34-15(2)29)37-23-9-8-17(10-21(23)32)24-12-20(31)19-6-4-5-7-22(19)36-24/h4-10,12,18,25-27,32H,11,13H2,1-3H3 |
| InChIKey | LDFXCZKYPXWMDA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|