C19H14F3N3OS — CID 59296528
3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 59296528) has the molecular formula C19H14F3N3OS and a molecular weight of 389.40 g/mol. Its IUPAC name is 3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 59296528 |
| Molecular Formula | C19H14F3N3OS |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-[4-isocyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(c3ccccc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C19H14F3N3OS/c1-18(2)16(26)24(17(27)25(18)12-7-5-4-6-8-12)13-9-10-15(23-3)14(11-13)19(20,21)22/h4-11H,1-2H3 |
| InChIKey | VBGNJMYMXACJLT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 27.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|