C21H44 — CID 59297460
2,6,7,7-tetramethyl-6-(3-methylhexan-3-yl)decane (PubChem CID 59297460) has the molecular formula C21H44 and a molecular weight of 296.58 g/mol. Its IUPAC name is 2,6,7,7-tetramethyl-6-(3-methylhexan-3-yl)decane.
| Compound Name | 2,6,7,7-tetramethyl-6-(3-methylhexan-3-yl)decane |
|---|---|
| PubChem CID | 59297460 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 2,6,7,7-tetramethyl-6-(3-methylhexan-3-yl)decane |
| SMILES | CCCC(C)(C)C(C)(CCCC(C)C)C(C)(CC)CCC |
| InChI | InChI=1S/C21H44/c1-10-15-19(6,7)21(9,17-13-14-18(4)5)20(8,12-3)16-11-2/h18H,10-17H2,1-9H3 |
| InChIKey | PVGQHDRMTQTTBR-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |