C18H30N4O2 — CID 59297755
(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropyl]amino]propanoyl]amino]-N-ethylbutanamide (PubChem CID 59297755) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropyl]amino]propanoyl]amino]-N-ethylbutanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropyl]amino]propanoyl]amino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 59297755 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropyl]amino]propanoyl]amino]-N-ethylbutanamide |
| SMILES | CCNC(=O)[C@H](CC)NC(=O)[C@H](C)NC[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C18H30N4O2/c1-4-16(18(24)20-5-2)22-17(23)13(3)21-12-15(19)11-14-9-7-6-8-10-14/h6-10,13,15-16,21H,4-5,11-12,19H2,1-3H3,(H,20,24)(H,22,23)/t13-,15-,16-/m0/s1 |
| InChIKey | SAQMBLCRSHXUAE-BPUTZDHNSA-N |
| XLogP | 0.57 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |