C15H32N4O2 — CID 87506133
(2S)-2-[[(2S)-2-[[(2R)-2-aminohexyl]amino]propanoyl]amino]-N-ethylbutanamide (PubChem CID 87506133) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2R)-2-aminohexyl]amino]propanoyl]amino]-N-ethylbutanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(2R)-2-aminohexyl]amino]propanoyl]amino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 87506133 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2R)-2-aminohexyl]amino]propanoyl]amino]-N-ethylbutanamide |
| SMILES | CCCC[C@@H](N)CN[C@@H](C)C(=O)N[C@@H](CC)C(=O)NCC |
| InChI | InChI=1S/C15H32N4O2/c1-5-8-9-12(16)10-18-11(4)14(20)19-13(6-2)15(21)17-7-3/h11-13,18H,5-10,16H2,1-4H3,(H,17,21)(H,19,20)/t11-,12+,13-/m0/s1 |
| InChIKey | ZOGIDMFVNZFAAN-XQQFMLRXSA-N |
| XLogP | 0.51 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |