C27H23ClFNO3 — CID 59299483
3-[2-[(2-chloro-6-fluorophenyl)methyl]pent-4-enoyl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 59299483) has the molecular formula C27H23ClFNO3 and a molecular weight of 463.94 g/mol. Its IUPAC name is 3-[2-[(2-chloro-6-fluorophenyl)methyl]pent-4-enoyl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[(2-chloro-6-fluorophenyl)methyl]pent-4-enoyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59299483 |
| Molecular Formula | C27H23ClFNO3 |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 3-[2-[(2-chloro-6-fluorophenyl)methyl]pent-4-enoyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | C=CCC(Cc1c(F)cccc1Cl)C(=O)N1C(=O)OC(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C27H23ClFNO3/c1-2-10-20(17-21-22(28)15-9-16-23(21)29)26(31)30-24(18-11-5-3-6-12-18)25(33-27(30)32)19-13-7-4-8-14-19/h2-9,11-16,20,24-25H,1,10,17H2 |
| InChIKey | LLZZLQMDHKFTAV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|