C16H29N3OSi — CID 59301298
2-N-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]pyridine-2,5-diamine (PubChem CID 59301298) has the molecular formula C16H29N3OSi and a molecular weight of 307.51 g/mol. Its IUPAC name is 2-N-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]pyridine-2,5-diamine.
| Compound Name | 2-N-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 59301298 |
| Molecular Formula | C16H29N3OSi |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 2-N-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]pyridine-2,5-diamine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@H](Nc2ccc(N)cn2)C1 |
| InChI | InChI=1S/C16H29N3OSi/c1-16(2,3)21(4,5)20-14-8-7-13(10-14)19-15-9-6-12(17)11-18-15/h6,9,11,13-14H,7-8,10,17H2,1-5H3,(H,18,19)/t13-,14-/m1/s1 |
| InChIKey | UQBMTXRGFWONIE-ZIAGYGMSSA-N |
| XLogP | 4.02 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|