C27H16N2O2Pt — CID 59302090
10H-benzo[h]quinolin-10-ide;platinum(2+);3-pyridin-2-yl-4H-chromen-4-id-2-one (PubChem CID 59302090) has the molecular formula C27H16N2O2Pt and a molecular weight of 595.52 g/mol. Its IUPAC name is 10H-benzo[h]quinolin-10-ide;platinum(2+);3-pyridin-2-yl-4H-chromen-4-id-2-one.
| Compound Name | 10H-benzo[h]quinolin-10-ide;platinum(2+);3-pyridin-2-yl-4H-chromen-4-id-2-one |
|---|---|
| PubChem CID | 59302090 |
| Molecular Formula | C27H16N2O2Pt |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 595.09 |
| IUPAC Name | 10H-benzo[h]quinolin-10-ide;platinum(2+);3-pyridin-2-yl-4H-chromen-4-id-2-one |
| SMILES | O=c1oc2ccccc2[c-]c1-c1ccccn1.[Pt+2].[c-]1cccc2ccc3cccnc3c12 |
| InChI | InChI=1S/C14H8NO2.C13H8N.Pt/c16-14-11(12-6-3-4-8-15-12)9-10-5-1-2-7-13(10)17-14;1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;/h1-8H;1-5,7-9H;/q2*-1;+2 |
| InChIKey | AGMNDWZPCNRJQO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|