About 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium
2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium (PubChem CID 59304192) has the molecular formula C11H15N2ORe-
and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium.
Molecular Properties
| Compound Name | 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium |
| PubChem CID | 59304192 |
| Molecular Formula | C11H15N2ORe- |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium |
| SMILES | CC(C)c1cnc(CC2CC2)[n-]c1=O.[Re] |
| InChI | InChI=1S/C11H16N2O.Re/c1-7(2)9-6-12-10(13-11(9)14)5-8-3-4-8;/h6-8H,3-5H2,1-2H3,(H,12,13,14);/p-1 |
| InChIKey | HCCJNDQXINXRKH-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 44.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium?
The IUPAC name of 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium (CID 59304192) is 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium.
What is the SMILES notation for 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium?
The canonical SMILES for 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium is CC(C)c1cnc(CC2CC2)[n-]c1=O.[Re].
What is the InChIKey of 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium?
The InChIKey is HCCJNDQXINXRKH-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H16N2O.Re/c1-7(2)9-6-12-10(13-11(9)14)5-8-3-4-8;/h6-8H,3-5H2,1-2H3,(H,12,13,14);/p-1.
What are the key properties of 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium?
2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium has a molecular weight of 377.46 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium is sourced from PubChem (CID 59304192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).